| HWiNFO64 v7.16-4650 |
| Creation Time | 21.01.2022 16:37 |
|
Content: |
| DESKTOP-RR2HMIK |
| [Current Computer] | ||
| Computer Brand Name: | DELL XPS 13 9310 | |
| [Operating System] | ||
| Central Processor(s) |
| [CPU Unit Count] | ||
| Number Of Processor Packages (Physical): | 1 | |
| Number Of Processor Cores: | 4 | |
| Number Of Logical Processors: | 8 | |
| Intel Core i7-1195G7 |
| [General Information] | ||
| Processor Name: | Intel Core i7-1195G7 | |
| Original Processor Frequency: | 2900.0 MHz | |
| Original Processor Frequency [MHz]: | 2900 | |
| CPU ID: | 000806C2 | |
| CPU Brand Name: | 11th Gen Intel(R) Core(TM) i7-1195G7 @ 2.90GHz | |
| CPU Vendor: | GenuineIntel | |
| CPU Stepping: | C0 | |
| CPU Code Name: | Tiger Lake-UP3 Refresh | |
| CPU Technology: | 10 nm | |
| CPU S-Spec: | SRKSC, SRKSB, SRKUJ, SRKUK | |
| CPU Thermal Design Power (TDP): | 28.0 W | |
| CPU Power Limits (Max): | Power = Unlimited, Time = Unlimited | |
| CPU Power Limit 1 (Long Duration)/Processor Base Power (PBP): | (28.00 W) (28.00 sec) [Unlocked] | |
| CPU Power Limit 2 (Short Duration)/Maximum Turbo Power (MTP): | (64.00 W) (2.44 ms) [Unlocked] | |
| Configurable TDP Level 1 (Down): | 12.00 W (Unlimited range), 1300 MHz | |
| Configurable TDP Level 2 (Up): | 15.00 W (Unlimited range), 1800 MHz | |
| Current Configurable TDP Level: | Nominal (Legacy) [Unlocked] | |
| CPU Max. Junction Temperature (Tj,max): | 100 °C | |
| CPU Type: | Production Unit | |
| CPU Platform: | BGA1449 | |
| Microcode Update Revision: | 16 | |
| Number of CPU Cores: | 4 | |
| Number of Logical CPUs: | 8 | |
| [Operating Points] | ||
| CPU MFM (LowPower): | 400.0 MHz = 4 x 100.0 MHz | |
| CPU LFM (Minimum): | 400.0 MHz = 4 x 100.0 MHz | |
| CPU HFM (Base): | 2900.0 MHz = 29 x 100.0 MHz | |
| CPU Turbo Max: | 5000.0 MHz = 50 x 100.0 MHz [Unlocked] | |
| Turbo Ratio Limits - IA/SSE: | 50x (1-2c), 48x (3-4c) | |
| Turbo Ratio Limits - AVX2, Resolved: | 50x (1-2c), 48x (3-4c) | |
| CPU Current: | 4433.3 MHz = 44 x 100.8 MHz @ 1.1324 V | |
| LLC/Ring Maximum: | 4200.0 MHz = 42.00 x 100.0 MHz | |
| LLC/Ring Current: | 4231.8 MHz = 42.00 x 100.8 MHz @ 1.0710 V | |
| CPU Bus Type: | OPI | |
| [Cache and TLB] | ||
| L1 Cache: | Instruction: 4 x 32 KBytes, Data: 4 x 48 KBytes | |
| L2 Cache: | Integrated: 4 x 1280 KBytes | |
| L3 Cache: | 12 MBytes | |
| Instruction TLB: | 2MB/4MB Pages, 8-way set associative, 2 sets | |
| Unified TLB: | 4KB/2MB/4MB Pages, 8-way set associative, 128 sets | |
| [Standard Feature Flags] | ||
| FPU on Chip | Present | |
| Enhanced Virtual-86 Mode | Present | |
| I/O Breakpoints | Present | |
| Page Size Extensions | Present | |
| Time Stamp Counter | Present | |
| Pentium-style Model Specific Registers | Present | |
| Physical Address Extension | Present | |
| Machine Check Exception | Present | |
| CMPXCHG8B Instruction | Present | |
| APIC On Chip / PGE (AMD) | Present | |
| Fast System Call | Present | |
| Memory Type Range Registers | Present | |
| Page Global Feature | Present | |
| Machine Check Architecture | Present | |
| CMOV Instruction | Present | |
| Page Attribute Table | Present | |
| 36-bit Page Size Extensions | Present | |
| Processor Number | Not Present | |
| CLFLUSH Instruction | Present | |
| Debug Trace and EMON Store | Present | |
| Internal ACPI Support | Present | |
| MMX Technology | Present | |
| Fast FP Save/Restore (IA MMX-2) | Present | |
| Streaming SIMD Extensions | Present | |
| Streaming SIMD Extensions 2 | Present | |
| Self-Snoop | Present | |
| Multi-Threading Capable | Present | |
| Automatic Clock Control | Present | |
| IA-64 Processor | Not Present | |
| Signal Break on FERR | Present | |
| Virtual Machine Extensions (VMX) | Present | |
| Safer Mode Extensions (Intel TXT) | Not Present | |
| Streaming SIMD Extensions 3 | Present | |
| Supplemental Streaming SIMD Extensions 3 | Present | |
| Streaming SIMD Extensions 4.1 | Present | |
| Streaming SIMD Extensions 4.2 | Present | |
| AVX Support | Present | |
| Fused Multiply Add (FMA) | Present | |
| Carryless Multiplication (PCLMULQDQ)/GFMUL | Present | |
| CMPXCHG16B Support | Present | |
| MOVBE Instruction | Present | |
| POPCNT Instruction | Present | |
| XSAVE/XRSTOR/XSETBV/XGETBV Instructions | Present | |
| XGETBV/XSETBV OS Enabled | Present | |
| Float16 Instructions | Present | |
| AES Cryptography Support | Present | |
| Random Number Read Instruction (RDRAND) | Present | |
| Extended xAPIC | Present | |
| MONITOR/MWAIT Support | Present | |
| Thermal Monitor 2 | Present | |
| Enhanced SpeedStep Technology | Present | |
| L1 Context ID | Not Present | |
| Send Task Priority Messages Disabling | Present | |
| Processor Context ID | Present | |
| Direct Cache Access | Not Present | |
| TSC-deadline Timer | Present | |
| Performance/Debug Capability MSR | Present | |
| IA32 Debug Interface Support | Present | |
| 64-Bit Debug Store | Present | |
| CPL Qualified Debug Store | Present | |
| [Extended Feature Flags] | ||
| 64-bit Extensions | Present | |
| RDTSCP and TSC_AUX Support | Present | |
| 1 GB large page support | Present | |
| No Execute | Present | |
| SYSCALL/SYSRET Support | Present | |
| Bit Manipulation Instructions Set 1 | Present | |
| Bit Manipulation Instructions Set 2 | Present | |
| Advanced Vector Extensions 2 (AVX2) | Present | |
| Advanced Vector Extensions 512 (AVX-512) Foundation | Present | |
| AVX-512 Prefetch Instructions | Not Present | |
| AVX-512 Exponential and Reciprocal Instructions | Not Present | |
| AVX-512 Conflict Detection Instructions | Present | |
| AVX-512 Doubleword and Quadword Instructions | Present | |
| AVX-512 Byte and Word Instructions | Present | |
| AVX-512 Vector Length Extensions | Present | |
| AVX-512 52-bit Integer FMA Instructions | Present | |
| Secure Hash Algorithm (SHA) Extensions | Present | |
| Software Guard Extensions (SGX) Support | Not Present | |
| Supervisor Mode Execution Protection (SMEP) | Present | |
| Supervisor Mode Access Prevention (SMAP) | Present | |
| Hardware Lock Elision (HLE) | Not Present | |
| Restricted Transactional Memory (RTM) | Not Present | |
| Memory Protection Extensions (MPX) | Not Present | |
| Read/Write FS/GS Base Instructions | Present | |
| Enhanced Performance String Instruction | Present | |
| INVPCID Instruction | Present | |
| RDSEED Instruction | Present | |
| Multi-precision Add Carry Instructions (ADX) | Present | |
| PCOMMIT Instructions | Not Present | |
| CLFLUSHOPT Instructions | Present | |
| CLWB Instructions | Present | |
| TSC_THREAD_OFFSET | Present | |
| Platform Quality of Service Monitoring (PQM) | Not Present | |
| Platform Quality of Service Enforcement (PQE) | Present | |
| FPU Data Pointer updated only on x87 Exceptions | Present | |
| Deprecated FPU CS and FPU DS | Present | |
| Intel Processor Trace | Present | |
| PREFETCHWT1 Instruction | Not Present | |
| AVX-512 Vector Bit Manipulation Instructions | Present | |
| AVX-512 Vector Bit Manipulation Instructions 2 | Present | |
| AVX-512 Galois Fields New Instructions | Present | |
| AVX-512 Vector AES | Present | |
| AVX-512 Vector Neural Network Instructions | Present | |
| AVX-512 Bit Algorithms | Present | |
| AVX-512 Carry-Less Multiplication Quadword (VPCLMULQDQ) | Present | |
| AVX-512 Vector POPCNT (VPOPCNTD/VPOPCNTQ) | Present | |
| User-Mode Instruction Prevention | Present | |
| Protection Keys for User-mode Pages | Present | |
| OS Enabled Protection Keys | Not Present | |
| Wait and Pause Enhancements (WAITPKG) | Not Present | |
| Total Memory Encryption | Not Present | |
| Key Locker | Present | |
| 57-bit Linear Addresses, 5-level Paging | Not Present | |
| Read Processor ID | Present | |
| Cache Line Demote | Not Present | |
| MOVDIRI: Direct Stores | Present | |
| MOVDIR64B: Direct Stores | Present | |
| ENQCMD: Enqueue Stores | Not Present | |
| SGX Launch Configuration | Not Present | |
| Protection Keys for Supervisor-Mode Pages | Not Present | |
| Control-Flow Enforcement Technology (CET) Shadow Stack | Present | |
| AVX-512 4 x Vector Neural Network Instructions Word Variable Precision | Not Present | |
| AVX-512 4 x Fused Multiply Accumulation Packed Single Precision | Not Present | |
| Fast Short REP MOV | Present | |
| User Interrupts | Not Present | |
| AVX-512 VP2INTERSECT Support | Present | |
| AVX-512 FP16 | Not Present | |
| MD_CLEAR Support | Present | |
| SERIALIZE | Not Present | |
| Hybrid Processor | Not Present | |
| TSX Suspend Load Address Tracking | Not Present | |
| Platform Configuration (PCONFIG) | Not Present | |
| Indirect Branch Restricted Speculation (IBRS), Indirect Branch Predictor Barrier (IBPB) | Present | |
| Single Thread Indirect Branch Predictors (STIBP) | Present | |
| L1D_FLUSH Support | Present | |
| IA32_ARCH_CAPABILITIES MSR | Present | |
| IA32_CORE_CAPABILITIES MSR | Present | |
| Speculative Store Bypass Disable (SSBD) | Present | |
| Control-Flow Enforcement Technology (CET) Indirect Branch Tracking | Present | |
| Advanced Matrix Extensions (AMX) Tile Architecture | Not Present | |
| Advanced Matrix Extensions (AMX) bfloat16 Support | Not Present | |
| Advanced Matrix Extensions (AMX) 8-bit Integer Operations | Not Present | |
| AVX (VEX-encoded) Vector Neural Network Instructions | Not Present | |
| AVX-512 BFLOAT16 Instructions | Not Present | |
| Fast Zero-Length MOVSB | Not Present | |
| Fast Short STOSB | Not Present | |
| Fast Short CMPSB, SCASB | Not Present | |
| History Reset | Not Present | |
| Linear Address Masking | Not Present | |
| [Vulnerability Mitigation Mechanisms] | ||
| Rogue Data Cache Load (RDCL) | Not Susceptible | |
| Speculative Store Bypass (SSB) | Susceptible | |
| Microarchitectural Data Sampling (MDS) | Not Susceptible | |
| MCE on modifying code page size without TLB invalidation | Not Susceptible | |
| Transactional Asynchronous Abort (TAA) | Affected | |
| Indirect Branch Restriction Speculation (IBRS) | Supported | |
| RSB Alternate | Not Supported | |
| L1D Flush on VM Entry Not Needed | Supported | |
| Energy Filtering Control | Not Supported | |
| [Enhanced Features] | ||
| Thermal Monitor 1: | Supported, Enabled | |
| Thermal Monitor 2: | Supported, Enabled | |
| Enhanced Intel SpeedStep (GV3): | Supported, Enabled | |
| Bi-directional PROCHOT#: | Enabled | |
| Extended Auto-HALT State C1E: | Enabled | |
| MLC Streamer Prefetcher | Supported, Enabled | |
| MLC Spatial Prefetcher | Supported, Enabled | |
| DCU Streamer Prefetcher | Supported, Enabled | |
| DCU IP Prefetcher | Supported, Enabled | |
| Intel Dynamic Acceleration (IDA) Technology: | Not Supported | |
| Intel Dynamic FSB Switching: | Not Supported | |
| Intel Turbo Boost Technology: | Supported, Enabled | |
| Programmable Ratio Limits: | Supported, Disabled | |
| Programmable TDC/TDP Limits: | Supported, Disabled | |
| Hardware Duty Cycling: | Supported, Enabled | |
| Intel Speed Select: | Not Supported | |
| [CPU SKU Features] | ||
| NVME: | Not Supported | |
| DMI x4 Width: | Supported | |
| DRAM ECC: | Not Supported | |
| VT-d: | Supported | |
| DMI in Gen2 Mode: | Supported | |
| PEG in Gen2 Mode: | Supported | |
| 1N Mode DDR Timings: | Supported | |
| Camarillo (DTT) Device: | Supported | |
| 2 DIMMs per Channel: | Not Supported | |
| X2APIC: | Supported | |
| Dual Memory Channel: | Supported | |
| Integrated GPU (IGD): | Enabled | |
| DDR Overclocking: | Disabled | |
| Overclocking by DSKU: | Disabled | |
| Maximum Memory Size per Channel: | 32 GB (unlimited) | |
| IMGU Device: | Not Supported | |
| Intel Processor Trace (Northpeak): | Supported | |
| Overclocking: | Disabled | |
| Hyper-Threading (SMT): | Supported | |
| Additive Graphics: | Supported | |
| Additive Graphics: | Enabled | |
| PCIe Gen 3: | Supported | |
| DMI Gen 3: | Supported | |
| HDCP: | Supported | |
| L Technology: | 1LM | |
| VMD: | Supported | |
| PCIe Gen 4: | Supported | |
| BCLK OC Limit: | 100 MHz | |
| DDR4: | Supported | |
| LPDDR4: | Supported | |
| Maximum Supported DDR4 Frequency: | 1600 MHz | |
| Maximum Supported LPDDR4 Frequency: | 2133 MHz | |
| Dynamic Memory Frequency (QCLK GV): | Supported | |
| Software Guard Extension (SGX): | Not Supported | |
| DDR5: | Not Supported | |
| LPDDR5: | Not Supported | |
| [Voltage Regulator (SVID)] | ||
| VCC VR: | Monolithic Pwr Sys (0x40), IMVP9 | |
| VR Thermal Sensor: | Not Supported | |
| [Memory Ranges] | ||
| Maximum Physical Address Size: | 39-bit (512 GBytes) | |
| Maximum Virtual Address Size: | 48-bit (256 TBytes) | |
| [MTRRs] | ||
| Range 80000000-100000000 (2048MB-4096MB) Type: | Uncacheable (UC) | |
| Range 70000000-80000000 (1792MB-2048MB) Type: | Uncacheable (UC) | |
| Range 6C000000-70000000 (1728MB-1792MB) Type: | Uncacheable (UC) | |
| Range 2000000000-4000000000 (131072MB-262144MB) Type: | Uncacheable (UC) | |
| Range 1000000000-2000000000 (65536MB-131072MB) Type: | Uncacheable (UC) | |
| Range 4000000000-8000000000 (262144MB-524288MB) Type: | Uncacheable (UC) | |
| Motherboard |
| [Computer] | ||
| Computer Brand Name: | DELL XPS 13 9310 | |
| [Motherboard] | ||
| Motherboard Model: | DELL 0TPHC1 | |
| Motherboard Chipset: | Intel Tiger Lake-UP3 PCH-LP | |
| Motherboard Slots: | 6xPCI Express x1, 1xPCI Express x16 | |
| PCI Express Version Supported: | v3.0 | |
| USB Version Supported: | v3.1 | |
| [BIOS] | ||
| BIOS Manufacturer: | Dell Inc. | |
| BIOS Date: | 12/13/2021 | |
| BIOS Version: | 3.4.0 | |
| UEFI BIOS: | Capable | |
| Super-IO/LPC Chip: | Unknown | |
| Trusted Platform Module (TPM) Chip: | Present, version v2.0 | |
| ACPI Devices |
| I2C HID Device |
| Device Name: | I2C HID Device | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| IRQ: | 1025 | |
| PS/2 Compatible Mouse |
| Device Name: | PS/2 Compatible Mouse | |
| [Assigned Resources] | ||
| IRQ: | 12 | |
| [Alternative 1] | ||
| IRQ: | 12 | |
| Standard PS/2 Keyboard |
| Device Name: | Standard PS/2 Keyboard | |
| [Assigned Resources] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0000 | |
| [Alternative 1] | ||
| I/O Port: | 0060 | |
| I/O Port: | 0064 | |
| IRQ: | 1 | |
| Intel(R) Serial IO GPIO Host Controller - INT34C5 |
| Device Name: | Intel(R) Serial IO GPIO Host Controller - INT34C5 | |
| [Assigned Resources] | ||
| IRQ: | 14 | |
| [Alternative 1] | ||
| Memory Location: | FD6E0000 | |
| Memory Location: | FD6D0000 | |
| Memory Location: | FD6A0000 | |
| Memory Location: | FD690000 | |
| IRQ: | 14 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 1854 - 1857 | |
| [Alternative 1] | ||
| I/O Port: | 1854 - 1857 | |
| Programmable interrupt controller |
| Device Name: | Programmable interrupt controller | |
| [Assigned Resources] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00B0 - 00B1 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 0020 - 0021 | |
| I/O Port: | 0024 - 0025 | |
| I/O Port: | 0028 - 0029 | |
| I/O Port: | 002C - 002D | |
| I/O Port: | 0030 - 0031 | |
| I/O Port: | 0034 - 0035 | |
| I/O Port: | 0038 - 0039 | |
| I/O Port: | 003C - 003D | |
| I/O Port: | 00A0 - 00A1 | |
| I/O Port: | 00A4 - 00A5 | |
| I/O Port: | 00A8 - 00A9 | |
| I/O Port: | 00AC - 00AD | |
| I/O Port: | 00B0 - 00B1 | |
| I/O Port: | 00B4 - 00B5 | |
| I/O Port: | 00B8 - 00B9 | |
| I/O Port: | 00BC - 00BD | |
| I/O Port: | 04D0 - 04D1 | |
| System timer |
| Device Name: | System timer | |
| [Assigned Resources] | ||
| I/O Port: | 0040 - 0043 | |
| DMA: | 0 | |
| [Alternative 1] | ||
| I/O Port: | 0040 - 0043 | |
| I/O Port: | 0050 - 0053 | |
| IRQ: | 0 | |
| High precision event timer |
| Device Name: | High precision event timer | |
| [Assigned Resources] | ||
| Memory Location: | FED00000 - FED003FF | |
| [Alternative 1] | ||
| Memory Location: | FED00000 - FED003FF | |
| PCI Express Root Complex |
| Device Name: | PCI Express Root Complex | |
| [Assigned Resources] | ||
| I/O Port: | 0000 - FFFFFFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| [Alternative 1] | ||
| I/O Port: | 0000 - 0CF7 | |
| I/O Port: | 0D00 - FFFF | |
| Memory Location: | 000A0000 - 000BFFFF | |
| Memory Location: | 70800000 - BFFFFFFF | |
| System CMOS/real time clock |
| Device Name: | System CMOS/real time clock | |
| [Assigned Resources] | ||
| I/O Port: | 0070 - 0077 | |
| [Alternative 1] | ||
| I/O Port: | 0070 - 0077 | |
| IRQ: | 8 | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FEDC0000 - FEDC7FFF | |
| Memory Location: | FED20000 - FED7FFFF | |
| [Alternative 1] | ||
| Memory Location: | FEDC0000 - FEDC7FFF | |
| Memory Location: | FEDA0000 - FEDA0FFF | |
| Memory Location: | FEDA1000 - FEDA1FFF | |
| Memory Location: | C0000000 - CFFFFFFF | |
| Memory Location: | FED20000 - FED7FFFF | |
| Memory Location: | FED90000 - FED93FFF | |
| Memory Location: | FED45000 - FED8FFFF | |
| Memory Location: | FEE00000 - FEEFFFFF | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 0065 | |
| I/O Port: | 0000 - 006F | |
| I/O Port: | 0092 | |
| IRQ: | 1114369 | |
| [Alternative 1] | ||
| I/O Port: | 002E - 002F | |
| I/O Port: | 004E - 004F | |
| I/O Port: | 0061 | |
| I/O Port: | 0063 | |
| I/O Port: | 0065 | |
| I/O Port: | 0067 | |
| I/O Port: | 0070 | |
| I/O Port: | 0080 | |
| I/O Port: | 0092 | |
| I/O Port: | 00B2 - 00B3 | |
| I/O Port: | 0680 - 069F | |
| I/O Port: | 164E - 164F | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| I/O Port: | 2000 - 20FE | |
| [Alternative 1] | ||
| I/O Port: | 2000 - 20FE | |
| Motherboard resources |
| Device Name: | Motherboard resources | |
| [Assigned Resources] | ||
| Memory Location: | FE000000 - FE01FFFF | |
| Memory Location: | FE200000 - FE7FFFFF | |
| [Alternative 1] | ||
| I/O Port: | 1800 - 18FE | |
| Memory Location: | FE000000 - FE01FFFF | |
| Memory Location: | FE04C000 - FE04FFFF | |
| Memory Location: | FE050000 | |
| Memory Location: | FE0D0000 | |
| Memory Location: | FE200000 | |
| Memory Location: | FF000000 | |
| Memory Location: | FD000000 | |
| Memory Location: | FD6B0000 | |
| Memory Location: | FD6F0000 | |
| Microsoft ACPI-Compliant Embedded Controller |
| Device Name: | Microsoft ACPI-Compliant Embedded Controller | |
| [Assigned Resources] | ||
| I/O Port: | 0930 | |
| [Alternative 1] | ||
| I/O Port: | 0930 | |
| I/O Port: | 0934 | |
| Trusted Platform Module 2.0 |
| Device Name: | Trusted Platform Module 2.0 | |
| [Assigned Resources] | ||
| Memory Location: | FED40000 - FED44FFF | |
| [Alternative 1] | ||
| Memory Location: | FED40000 - FED44FFF | |
| UCM-UCSI ACPI Device |
| Device Name: | UCM-UCSI ACPI Device | |
| [Assigned Resources] | ||
| Memory Location: | 62903000 - 62903FFF | |
| [Alternative 1] | ||
| Memory Location: | 62903000 - 62903FFF | |
| I2C HID Device |
| Device Name: | I2C HID Device | |
| [Assigned Resources] | ||
| [Alternative 1] | ||
| IRQ: | 1024 | |
| SMBIOS DMI |
| BIOS |
| BIOS Vendor: | Dell Inc. | |
| BIOS Version: | 3.4.0 | |
| BIOS Release Date: | 12/13/2021 | |
| BIOS Start Segment: | 0 | |
| BIOS Size: | 32 MBytes | |
| System BIOS Version: | 3.4 | |
| ISA Support: | Not Present | |
| MCA Support: | Not Present | |
| EISA Support: | Not Present | |
| PCI Support: | Present | |
| PC Card (PCMCIA) Support: | Not Present | |
| Plug-and-Play Support: | Present | |
| APM Support: | Not Present | |
| Flash BIOS: | Present | |
| BIOS Shadow: | Present | |
| VL-VESA Support: | Not Present | |
| ESCD Support: | Not Present | |
| Boot from CD: | Present | |
| Selectable Boot: | Present | |
| BIOS ROM Socketed: | Not Present | |
| Boot from PC Card: | Not Present | |
| EDD Support: | Present | |
| NEC PC-98 Support: | Not Present | |
| ACPI Support: | Present | |
| USB Legacy Support: | Present | |
| AGP Support: | Not Present | |
| I2O Boot Support: | Not Present | |
| LS-120 Boot Support: | Not Present | |
| ATAPI ZIP Drive Boot Support: | Not Present | |
| IEE1394 Boot Support: | Not Present | |
| Smart Battery Support: | Present | |
| BIOS Boot Specification Support: | Present | |
| Function key-initiated Network Service Boot Support: | Present | |
| Targeted Content Distribution Support: | Present | |
| UEFI Specification Support: | Present | |
| Virtual Machine: | Not Present |
| System |
| System Manufacturer: | Dell Inc. | |
| Product Name: | XPS 13 9310 | |
| Product Version: | ||
| Product Serial Number: | BTGP0J3 | |
| UUID: | {4C4C4544-0054-4710-8050-C2C04F304A33} | |
| SKU Number: | 0AFC | |
| Family: | XPS |
| Mainboard |
| Mainboard Manufacturer: | Dell Inc. | |
| Mainboard Name: | 0TPHC1 | |
| Mainboard Version: | A01 | |
| Mainboard Serial Number: | /BTGP0J3/CNCMK001A201AF/ | |
| Asset Tag: | ||
| Location in chassis: |
| System Enclosure |
| Manufacturer: | Dell Inc. | |
| Case Type: | Notebook | |
| Version: | ||
| Serial Number: | BTGP0J3 | |
| Asset Tag Number: |
| Processor |
| Processor Manufacturer: | Intel(R) Corporation | |
| Processor Version: | 11th Gen Intel(R) Core(TM) i7-1195G7 @ 2.90GHz | |
| External Clock: | 100 MHz | |
| Maximum Clock Supported: | 2900 MHz | |
| Current Clock: | 2900 MHz | |
| CPU Socket: | Populated | |
| CPU Status: | Enabled | |
| Processor Type: | Central Processor | |
| Processor Voltage: | 0.8 V | |
| Processor Upgrade: | Unknown (1) | |
| Socket Designation: | CPU 1 |
| L1 Cache |
| Socket Designation: | L1 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L1 Data | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Parity | |
| Maximum Cache Size: | 192 KBytes | |
| Installed Cache Size: | 192 KBytes | |
| Cache Associativity: | 12-way Set-Associative |
| L1 Cache |
| Socket Designation: | L1 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L1 Instruction | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Parity | |
| Maximum Cache Size: | 128 KBytes | |
| Installed Cache Size: | 128 KBytes | |
| Cache Associativity: | 8-way Set-Associative |
| L2 Cache |
| Socket Designation: | L2 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L2 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Single-bit ECC | |
| Maximum Cache Size: | 5120 KBytes | |
| Installed Cache Size: | 5120 KBytes | |
| Cache Associativity: | Unknown |
| L3 Cache |
| Socket Designation: | L3 Cache | |
| Cache State: | Enabled | |
| Cache Location: | Internal | |
| Cache Type: | L3 Unified | |
| Cache Scheme: | Write-Back | |
| Supported SRAM Type: | Synchronous | |
| Current SRAM Type: | Synchronous | |
| Cache Speed: | Unknown | |
| Error Correction Type: | Multi-bit ECC | |
| Maximum Cache Size: | 12288 KBytes | |
| Installed Cache Size: | 12288 KBytes | |
| Cache Associativity: | 12-way Set-Associative |
| OEM Strings |
| Dell System | ||
| 1[0AFC] | ||
| 3[1.0] | ||
| 12[www.dell.com] | ||
| 14[1] | ||
| 15[0] | ||
| 27[25726165743] |
| System Configuration Options |
| J6H1:1-X Boot with Default; J8H1:1-X BIOS RECOVERY |
| BIOS Language |
| enUS <Active> |
| Group Associations |
| Group Associations |
| Built-in Pointing Device |
| Device Type: | Touch Pad | |
| Interface Type: | Bus mouse | |
| Number of Buttons: | 2 |
| Portable Battery |
| Battery Location: | Sys. Battery Bay | |
| Battery Manufacturer: | SMP | |
| Manufacture Date: | 06/11/2021 | |
| Serial Number: | 06E7 | |
| Device Name: | DELL WN0N016 | |
| Device Chemistry: | Unknown | |
| Design Capacity: | 50970 mWh | |
| Design Voltage: | 7600 mV | |
| SBDS Verison Number: | 1.0 | |
| Max. Error in Battery Data: | 7 | |
| SBDS Serial Number: | 1767 | |
| SBDS Manufacture Date: | 6/11/41 | |
| SBDS Device Chemistry: | LiP |
| System Power Controls |
| Cooling Device |
| Type: | Fan | |
| Description: | Processor Fan | |
| Status: | OK | |
| Nominal Speed: | 8000 RPM |
| Cooling Device |
| Type: | Fan | |
| Description: | Video Fan | |
| Status: | OK | |
| Nominal Speed: | 8000 RPM |
| Temperature Probe |
| Description: | CPU | |
| Location: | Processor Module | |
| Status: | OK | |
| Maximum Value: | 127.0 °C | |
| Minimum Value: | -127.0 °C | |
| Nominal Value: | 10.0 °C | |
| Resolution: | 1.000 °C | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Temperature Probe |
| Description: | DIMM A | |
| Location: | Memory Module | |
| Status: | OK | |
| Maximum Value: | 127.0 °C | |
| Minimum Value: | -127.0 °C | |
| Nominal Value: | 10.0 °C | |
| Resolution: | 1.000 °C | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Temperature Probe |
| Description: | SKIN | |
| Location: | Motherboard | |
| Status: | OK | |
| Maximum Value: | 127.0 °C | |
| Minimum Value: | -127.0 °C | |
| Nominal Value: | 10.0 °C | |
| Resolution: | 1.000 °C | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Temperature Probe |
| Description: | SKIN | |
| Location: | Motherboard | |
| Status: | OK | |
| Maximum Value: | 127.0 °C | |
| Minimum Value: | -127.0 °C | |
| Nominal Value: | 10.0 °C | |
| Resolution: | 1.000 °C | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Temperature Probe |
| Description: | SKIN | |
| Location: | Motherboard | |
| Status: | OK | |
| Maximum Value: | 127.0 °C | |
| Minimum Value: | -127.0 °C | |
| Nominal Value: | 10.0 °C | |
| Resolution: | 1.000 °C | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| Temperature Probe |
| Description: | SKIN | |
| Location: | Motherboard | |
| Status: | OK | |
| Maximum Value: | 127.0 °C | |
| Minimum Value: | -127.0 °C | |
| Nominal Value: | 10.0 °C | |
| Resolution: | 1.000 °C | |
| Tolerance: | Unknown | |
| Accuracy: | Unknown |
| System Boot Information |
| Boot Status: | No error occurred |
| System Power Supply |
| Location: | ||
| Device Name: | ||
| Manufacturer: | ||
| Serial Number: | ||
| Asset Tag Number: | ||
| Model Part Number: | ||
| Revision Level: | ||
| Power Supply Status: | Present | |
| Power Supply Type: | Unknown | |
| Power Status: | Unknown | |
| Hot replaceable: | No | |
| Unplugged from wall: | No |
| On Board Device |
| Device Description: | Onboard - Video | |
| Device Type: | Video Adapter | |
| Device Status: | Enabled | |
| On Board Device |
| Device Description: | Onboard - Sound | |
| Device Type: | Audio Device | |
| Device Status: | Disabled | |
| On Board Device |
| Device Description: | ||
| Device Type: | Unknown | |
| Device Status: | Disabled | |
| On Board Device |
| Device Description: | None | |
| Device Type: | Unknown | |
| Device Status: | Disabled | |
| TPM |
| TPM Specification Version: | 2.0 | |
| TPM Vendor: | STM | |
| TPM Description: | TPM 2.0, ManufacturerID: STM , Firmware Version: 0x00010101.0x0 |
| Intel AMT |
| Intel AMT Support: | Not Supported |
| Intel vPro |
| CPU VT-x Support: | Supported | |
| CPU VT-x Status: | Enabled | |
| CPU VT-x2 Support: | Not Supported | |
| CPU VT-x2 Status: | Disabled | |
| CPU TXT Support: | Not Supported | |
| CPU TXT Status: | Disabled | |
| CPU VMX Status: | Enabled | |
| CPU SMX Status: | Disabled | |
| Intel ME Status: | Enabled | |
| Intel OST Firmware Support: | Not Supported | |
| Intel ASF Firmware Support: | Not Supported | |
| Intel AMT Pro Firmware Support: | Not Supported | |
| Intel AMT Basic Firmware Support: | Not Supported | |
| Intel TPM Firmware Support: | Not Supported | |
| Intel Castle Peak Support: | Not Supported | |
| Intel WoX Support: | Not Supported | |
| Intel Virtualization Engine Support: | Not Supported | |
| Intel Anti-Theft Technology Support: | Not Supported | |
| TPM On-board: | Not Supported | |
| Intel Anti-Theft Technology Enrolled: | Not Supported | |
| Intel ME Version: | v15.0, Build 1951, Hotfix 35 | |
| BIOS VT-x Support: | Not Supported | |
| BIOS VT-d Support: | Supported | |
| BIOS TXT Support: | Not Supported | |
| BIOS TPM Support: | Not Supported | |
| BIOS ME Support: | Not Supported | |
| BIOS VA Extensions Support: | Supported | |
| Intel AT PBA For Recovery Support: | Not Supported | |
| Intel AT WWAN Support: | Not Supported |
| Firmware Version Information |
| BIOS Guard | 2.0.0.4687 |
| Firmware Version Information |
| Reference Code - CPU | 10.0.78.17 | |
| uCode Version | 0.0.0.22 | |
| TXT ACM version | 1.14.25.0 |
| Firmware Version Information |
| Reference Code - ME | 10.0.78.17 | |
| MEBx version | 15.0.0.4 | |
| ME Firmware Version | Consumer SKU |
| Firmware Version Information |
| Reference Code - PCH | 10.0.78.17 | |
| PCH-CRID Status | Disabled | |
| PCH-CRID Original Value | 0x30 | |
| PCH-CRID New Value | 0x30 | |
| OPROM - RST - RAID | 2.10.0.0 | |
| PCH Hsio Version | 4.0.0.0 |
| Firmware Version Information |
| Reference Code - SA - System Agent | 10.0.78.17 | |
| Reference Code - MRC | 2.0.2.0 | |
| SA - PCIe Version | 10.0.78.17 | |
| SA-CRID Status | Disabled | |
| SA-CRID Original Value | 0.0.0.2 | |
| SA-CRID New Value | 0.0.0.2 | |
| OPROM - VBIOS | ||
| IO Manageability Engine FW Version | 17.1.6.0 | |
| PHY Build Version | 0.0.0.193 | |
| Thunderbolt(TM) FW Version | 43.1.0.0 | |
| System Agent Manageability Engine FW Version |
| Firmware Version Information |
| FSP Binary Version | 4.0.0.0 |
| Firmware Version Information |
| Lan Phy Version | ||
| Sensor Firmware Version | ||
| Debug Mode Status | Disabled | |
| Performance Mode Status | Disabled | |
| Debug Use USB(Disabled:Serial) | Disabled | |
| ICC Overclocking Version | 0.0.0.0 | |
| UNDI Version | ||
| EC FW Version | 0.0 | |
| GOP Version | 0.23.0.4192 | |
| Royal Park Version | ||
| Platform Version | 0.7.0.0 | |
| Client Silicon Version | 0.2.0.15 |
| Memory Devices |
| Physical Memory Array |
| Array Location: | System board | |
| Array Use: | System memory | |
| Error Detecting Method: | None | |
| Memory Capacity: | 32 GBytes | |
| Memory Devices: | 8 |
| Memory Device |
| Total Width: | 16 bits | |
| Data Width: | 16 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | Row of chips | |
| Device Locator: | Motherboard | |
| Bank Locator: | ||
| Device Type: | LPDDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 4267 MHz | |
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Device |
| Total Width: | 16 bits | |
| Data Width: | 16 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | Row of chips | |
| Device Locator: | Motherboard | |
| Bank Locator: | ||
| Device Type: | LPDDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 4267 MHz | |
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Device |
| Total Width: | 16 bits | |
| Data Width: | 16 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | Row of chips | |
| Device Locator: | Motherboard | |
| Bank Locator: | ||
| Device Type: | LPDDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 4267 MHz | |
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Device |
| Total Width: | 16 bits | |
| Data Width: | 16 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | Row of chips | |
| Device Locator: | Motherboard | |
| Bank Locator: | ||
| Device Type: | LPDDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 4267 MHz | |
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Device |
| Total Width: | 16 bits | |
| Data Width: | 16 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | Row of chips | |
| Device Locator: | Motherboard | |
| Bank Locator: | ||
| Device Type: | LPDDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 4267 MHz | |
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Device |
| Total Width: | 16 bits | |
| Data Width: | 16 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | Row of chips | |
| Device Locator: | Motherboard | |
| Bank Locator: | ||
| Device Type: | LPDDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 4267 MHz | |
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Device |
| Total Width: | 16 bits | |
| Data Width: | 16 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | Row of chips | |
| Device Locator: | Motherboard | |
| Bank Locator: | ||
| Device Type: | LPDDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 4267 MHz | |
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Device |
| Total Width: | 16 bits | |
| Data Width: | 16 bits | |
| Device Size: | 4096 MBytes | |
| Device Form Factor: | Row of chips | |
| Device Locator: | Motherboard | |
| Bank Locator: | ||
| Device Type: | LPDDR4 | |
| Device Type Detail: | Synchronous | |
| Memory Speed: | 4267 MHz | |
| Manufacturer: | ||
| Serial Number: | ||
| Part Number: | ||
| Asset Tag: |
| Memory Array Mapped Address |
| Starting Address: | 00000000 | |
| Ending Address: | 01FFFFFF | |
| Partition Width: | 8 |
| Port Connectors |
| Keyboard Port |
| Port Type: | Keyboard Port | |
| Internal Reference: | Keyboard | |
| Internal Connector Type: | PS/2 | |
| External Reference: | None | |
| External Connector Type: | None |
| Mouse Port |
| Port Type: | Mouse Port | |
| Internal Reference: | Mouse | |
| Internal Connector Type: | PS/2 | |
| External Reference: | None | |
| External Connector Type: | None |
| USB |
| Port Type: | USB | |
| Internal Reference: | None | |
| Internal Connector Type: | None | |
| External Reference: | USB1 | |
| External Connector Type: | Access Bus (USB) |
| USB |
| Port Type: | USB | |
| Internal Reference: | None | |
| Internal Connector Type: | None | |
| External Reference: | USB2 | |
| External Connector Type: | Access Bus (USB) |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J9A1 - TPM/PORT 80 | |
| Internal Connector Type: | Unknown | |
| External Reference: | None | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J8E1 - SPI Program | |
| Internal Connector Type: | Unknown | |
| External Reference: | None | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J5J1 - FP Header | |
| Internal Connector Type: | Unknown | |
| External Reference: | None | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J1H2 - BATT A | |
| Internal Connector Type: | Unknown | |
| External Reference: | None | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J2G1 - CPU Fan | |
| Internal Connector Type: | Unknown | |
| External Reference: | None | |
| External Connector Type: | None |
| Port Connector |
| Port Type: | Unknown | |
| Internal Reference: | J4C1 - FAN PWR | |
| Internal Connector Type: | Unknown | |
| External Reference: | None | |
| External Connector Type: | None |
| System Slots |
| PCI-Express 0 |
| Slot Designation: | PCI-Express 0 | |
| Slot Type: | PCI Express x16 | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 16x / x16 | |
| Slot Length: | Long | |
| Base Bus:Device:Function Number: | 0:28:0 |
| PCI-Express 1 |
| Slot Designation: | PCI-Express 1 | |
| Slot Type: | PCI Express | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Long | |
| Base Bus:Device:Function Number: | 0:28:1 |
| PCI-Express 2 |
| Slot Designation: | PCI-Express 2 | |
| Slot Type: | PCI Express | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Long | |
| Base Bus:Device:Function Number: | 0:28:2 |
| PCI-Express 3 |
| Slot Designation: | PCI-Express 3 | |
| Slot Type: | PCI Express | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Long | |
| Base Bus:Device:Function Number: | 0:28:3 |
| PCI-Express 4 |
| Slot Designation: | PCI-Express 4 | |
| Slot Type: | PCI Express | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Long | |
| Base Bus:Device:Function Number: | 0:28:4 |
| PCI-Express 5 |
| Slot Designation: | PCI-Express 5 | |
| Slot Type: | PCI Express | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Long | |
| Base Bus:Device:Function Number: | 0:28:5 |
| PCI-Express 6 |
| Slot Designation: | PCI-Express 6 | |
| Slot Type: | PCI Express | |
| Slot Usage: | Empty | |
| Slot Data Bus Width: | 1x / x1 | |
| Slot Length: | Long | |
| Base Bus:Device:Function Number: | 0:28:6 |
| Intel ME |
| [ME Host Status] | ||
| ME Current Working State: | Normal | |
| Manufacturing Mode: | Not Active | |
| ME Current Operation Mode: | Normal | |
| Boot Guard Status: | Enabled | |
| Boot Guard Verified Boot Policy: | Enabled | |
| Boot Guard Measured Boot Policy: | Enabled | |
| [Intel Manageability Engine Features] | ||
| Intel ME Version: | 15.0, Build 1951, Hot Fix 35 | |
| Intel ME Recovery Image Version: | 15.0, Build 1951, Hot Fix 35 | |
| Intel ME FITC Version: | 15.0, Build 1776, Hot Fix 30 | |
| [ME Firmware Capabilities] | ||
| Full Network Manageability: | Not Capable | |
| Standard Network Manageability: | Not Capable | |
| Manageability (AMT): | Not Capable | |
| Small Business Advantage: | Not Capable | |
| Intel Integrated Touch: | Not Capable | |
| Intel Anti-Theft: | Not Capable | |
| Capability Licensing Service: | Not Capable | |
| Virtualization Engine: | Not Capable | |
| Intel Sensor Hub (ISH): | Capable | |
| ICC Over Clocking: | Not Capable | |
| Protected Audio Video Path (PAVP): | Capable | |
| Network Frame Forwarder (NFF): | Not Capable | |
| Remote PC Assist (RPAT): | Not Capable | |
| IPV6: | Not Capable | |
| KVM Remote Control: | Not Capable | |
| Outbreak Containment Heuristic (OCH): | Not Capable | |
| Dynamic Application Loader (DAL): | Capable | |
| Cipher Transport Layer (TLS): | Not Capable | |
| Wireless LAN (WLAN): | Not Capable | |
| Platform Trust Technology (PTT): | Capable | |
| Near Field Communication (NFC): | Not Capable | |
| [ME Firmware Feature State] | ||
| Full Network Manageability: | Disabled | |
| Standard Network Manageability: | Disabled | |
| Manageability (AMT): | Disabled | |
| Small Business Advantage: | Not Capable | |
| MEI3: | Not Capable | |
| Intel Anti-Theft: | Disabled | |
| Capability Licensing Service: | Disabled | |
| Virtualization Engine: | Disabled | |
| Intel Sensor Hub (ISH): | Enabled | |
| ICC Over Clocking: | Disabled | |
| Protected Audio Video Path (PAVP): | Enabled | |
| Network Frame Forwarder (NFF): | Not Capable | |
| Remote PC Assist (RPAT): | Disabled | |
| IPV6: | Disabled | |
| KVM Remote Control: | Disabled | |
| Outbreak Containment Heuristic (OCH): | Disabled | |
| Dynamic Application Loader (DAL): | Capable | |
| Cipher Transport Layer (TLS): | Disabled | |
| Wireless LAN (WLAN): | Disabled | |
| Platform Trust Technology (PTT): | Disabled | |
| Near Field Communication (NFC): | Disabled | |
| [ME Firmware Platform Type] | ||
| Platform Target Usage Type: | Mobile | |
| SKU: | Regular SKU | |
| ME Firmware Image Type: | Consumer SKU Firmware | |
| Platform Brand: | None | |
| Host ME Region Flash Protection Override (HMRFPO) Status: | Locked | |
| Memory |
| [General information] | ||
| Total Memory Size: | 32 GBytes | |
| Total Memory Size [MB]: | 32768 | |
| [Current Performance Settings] | ||
| Maximum Supported Memory Clock: | 2133.3 MHz | |
| Current Memory Clock: | 2149.5 MHz | |
| Current Timing (tCAS-tRCD-tRP-tRAS): | 40-39-39-90 | |
| Memory Channels Supported: | 4 | |
| Memory Channels Active: | 4 | |
| Command Rate: | 1T | |
| Read to Read Delay (tRDRD_SG/TrdrdScL) Same Bank Group: | 16T | |
| Read to Read Delay (tRDRD_DG/TrdrdScDlr) Different Bank Group: | 16T | |
| Read to Read Delay (tRDRD_SD) Same DIMM: | 28T | |
| Read to Read Delay (tRDRD_DD) Different DIMM: | 28T | |
| Write to Write Delay (tWRWR_SG/TwrwrScL) Same Bank Group: | 16T | |
| Write to Write Delay (tWRWR_DG/TwrwrScDlr) Different Bank Group: | 16T | |
| Write to Write Delay (tWRWR_SD) Same DIMM: | 28T | |
| Write to Write Delay (tWRWR_DD) Different DIMM: | 28T | |
| Read to Write Delay (tRDWR_SG/TrdwrScL) Same Bank Group: | 40T | |
| Read to Write Delay (tRDWR_DG/TrdwrScDlr) Different Bank Group: | 40T | |
| Read to Write Delay (tRDWR_SD) Same DIMM: | 40T | |
| Read to Write Delay (tRDWR_DD) Different DIMM: | 40T | |
| Write to Read Delay (tWRRD_SG/TwrrdScL) Same Bank Group: | 14T | |
| Write to Read Delay (tWRRD_DG/TwrrdScDlr) Different Bank Group: | 2T | |
| Write to Read Delay (tWRRD_SD) Same DIMM: | 20T | |
| Write to Read Delay (tWRRD_DD) Different DIMM: | 20T | |
| RAS# to RAS# Delay (tRRD): | 16T | |
| Row Cycle Time (tRC): | 129T | |
| Refresh Cycle Time (tRFC): | 598T | |
| Four Activate Window (tFAW): | 64T | |
| Bus |
| PCI Bus #0 |
| Intel Tiger Lake-UP3-R/H35 - Host Controller |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-UP3-R/H35 - Host Controller | |
| Original Device Name: | Intel Tiger Lake-UP3-R/H35 - Host Controller | |
| Device Class: | Host-to-PCI Bridge | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 0:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9A14&SUBSYS_0AFC1028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (표준 시스템 장치) | |
| Driver Description: | PCI 표준 호스트 CPU 브리지 | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1202 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9A14&SUBSYS_0AFC1028&REV_02\3&11583659&0&00 | |
| Location Paths | PCIROOT(0)#PCI(0000) | |
| Intel Tiger Lake-UP3 - GT2 Integrated Graphics |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-UP3 - GT2 Integrated Graphics | |
| Original Device Name: | Intel Tiger Lake-UP3 - GT2 Integrated Graphics | |
| Device Class: | VGA Compatible Adapter | |
| Revision ID: | 3 | |
| PCI Address (Bus:Device:Function) Number: | 0:2:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9A49&SUBSYS_0AFC1028&REV_03 | |
| [PCI Express] | ||
| Version: | 2.0 | |
| Current Link Width: | Not negotiated | |
| Maximum Link Speed: | 5.0 GT/s | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| Resizable BAR Support: | Not Supported | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 6054000000 | |
| Memory Base Address 2 | 4000000000 | |
| I/O Base Address 4 | 3000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Iris(R) Xe Graphics | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.0.100.9955 | |
| Driver Date: | 07-Oct-2021 | |
| DCH/UWD Driver: | Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9A49&SUBSYS_0AFC1028&REV_03\3&11583659&0&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Intel Tiger Lake - Dynamic Platform & Thermal Framework Processor Participant |
| [General Information] | ||
| Device Name: | Intel Tiger Lake - Dynamic Platform & Thermal Framework Processor Participant | |
| Original Device Name: | Intel Tiger Lake - Dynamic Platform & Thermal Framework Processor Participant | |
| Device Class: | Other Data Acquisition/Signal Processing Controller | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 0:4:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9A03&SUBSYS_0AFC1028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 7FFFEC0000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Intel(R) Dynamic Tuning Processor Participant | |
| Driver Provider: | Intel | |
| Driver Version: | 8.7.10600.20700 | |
| Driver Date: | 12-Mar-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9A03&SUBSYS_0AFC1028&REV_02\3&11583659&0&20 | |
| Location Paths | PCIROOT(0)#PCI(0400) | |
| Intel Volume Management Device (VMD) PCIe Compliance Function |
| [General Information] | ||
| Device Name: | Intel Volume Management Device (VMD) PCIe Compliance Function | |
| Original Device Name: | Intel Volume Management Device (VMD) PCIe Compliance Function | |
| Device Class: | Unknown Peripheral Device | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:6:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_09AB&SUBSYS_00000000&REV_00 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel RST VMD Managed Controller 09AB | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 18.6.4.1022 | |
| Driver Date: | 03-Sep-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_09AB&SUBSYS_00000000&REV_00\3&11583659&0&30 | |
| Location Paths | PCIROOT(0)#PCI(0600) | |
| Intel Tiger Lake - Gaussian Mixture Model (GNA) |
| [General Information] | ||
| Device Name: | Intel Tiger Lake - Gaussian Mixture Model (GNA) | |
| Original Device Name: | Intel Tiger Lake - Gaussian Mixture Model (GNA) | |
| Device Class: | Unknown Peripheral Device | |
| Revision ID: | 2 | |
| PCI Address (Bus:Device:Function) Number: | 0:8:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9A11&SUBSYS_0AFC1028&REV_02 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 7FFFEE7000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) GNA Scoring Accelerator module | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 2.0.0.1097 | |
| Driver Date: | 30-Oct-2020 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9A11&SUBSYS_0AFC1028&REV_02\3&11583659&0&40 | |
| Location Paths | PCIROOT(0)#PCI(0800) | |
| Intel Tiger Lake - Crash-log SRAM |
| [General Information] | ||
| Device Name: | Intel Tiger Lake - Crash-log SRAM | |
| Original Device Name: | Intel Tiger Lake - Crash-log SRAM | |
| Device Class: | Other Data Acquisition/Signal Processing Controller | |
| Revision ID: | 1 | |
| PCI Address (Bus:Device:Function) Number: | 0:10:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9A0D&SUBSYS_0AFC1028&REV_01 | |
| [PCI Express] | ||
| Version: | 2.0 | |
| Current Link Width: | Not negotiated | |
| Maximum Link Speed: | 5.0 GT/s | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| Resizable BAR Support: | Not Supported | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| Memory Base Address 0 | 60552D0000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel(R) 원격 분석 수집기 장치 | |
| Driver Description: | Intel(R) Tigerlake 원격 분석 수집기 드라이버 | |
| Driver Provider: | Intel(R) 원격 분석 수집기 장치 | |
| Driver Version: | 10.0.19041.546 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9A0D&SUBSYS_0AFC1028&REV_01\3&11583659&0&50 | |
| Location Paths | PCIROOT(0)#PCI(0A00) | |
| Intel Tiger Lake - Volume Management Device (VMD) NVMe RAID Controller |
| [General Information] | ||
| Device Name: | Intel Tiger Lake - Volume Management Device (VMD) NVMe RAID Controller | |
| Original Device Name: | Intel Tiger Lake - Volume Management Device (VMD) NVMe RAID Controller | |
| Device Class: | RAID controller | |
| Revision ID: | 0 | |
| PCI Address (Bus:Device:Function) Number: | 0:14:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_9A0B&SUBSYS_0AFC1028&REV_00 | |
| [PCI Express] | ||
| Version: | 2.0 | |
| Current Link Width: | Not negotiated | |
| Maximum Link Speed: | 5.0 GT/s | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| Resizable BAR Support: | Not Supported | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| Memory Base Address 0 | 6052000000 | |
| Memory Base Address 2 | A4000000 | |
| Memory Base Address 4 | 6055100000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel RST VMD Controller 9A0B | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 18.6.4.1022 | |
| Driver Date: | 03-Sep-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9A0B&SUBSYS_0AFC1028&REV_00\3&11583659&0&70 | |
| Location Paths | PCIROOT(0)#PCI(0E00) | |
| Intel Tiger Lake-U/Y PCH-LP - Integrated Sensor Hub |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - Integrated Sensor Hub | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - Integrated Sensor Hub | |
| Device Class: | RS-232 Serial Port | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:18:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0FC&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | IRQ16 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 7FFFEF0000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Intel(R) Integrated Sensor Solution | |
| Driver Provider: | Intel | |
| Driver Version: | 3.1.0.4466 | |
| Driver Date: | 30-Dec-2020 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0FC&SUBSYS_0AFC1028&REV_30\3&11583659&0&90 | |
| Location Paths | PCIROOT(0)#PCI(1200) | |
| Intel Tiger Lake-U/Y PCH-LP - USB 3.2 Gen 2x1 (10 Gb/s) xHCI Host Controller |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - USB 3.2 Gen 2x1 (10 Gb/s) xHCI Host Controller | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - USB 3.2 Gen 2x1 (10 Gb/s) xHCI Host Controller | |
| Device Class: | USB xHCI Controller | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:20:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0ED&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 60552A0000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| USB Version Supported: | 3.1 | |
| [Driver Information] | ||
| Driver Manufacturer: | 일반 USB xHCI 호스트 컨트롤러 | |
| Driver Description: | USB xHCI 규격 호스트 컨트롤러 | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1320 | |
| Driver Date: | 13-Oct-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0ED&SUBSYS_0AFC1028&REV_30\3&11583659&0&A0 | |
| Location Paths | PCIROOT(0)#PCI(1400) | |
| USB Root Hub |
| [Port1] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : Goodix fingerprint |
| [Device Information] | ||
| Device Manufacturer: | - | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Goodix fingerprint | |
| Hardware ID: | USB\VID_27C6&PID_533C | |
| [Driver Information] | ||
| Driver Manufacturer: | Goodix | |
| Driver Description: | Goodix fingerprint | |
| Driver Provider: | Goodix | |
| Driver Version: | 3.0.37.600 | |
| Driver Date: | 08-Jun-2020 | |
| DeviceInstanceId | USB\VID_27C6&PID_533C\5&165308C1&0&3 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3) | |
| [Port4] : No Device Connected |
| [Port5] : No Device Connected |
| [Port6] : Creative Technology, PID=800A |
| [Device Information] | ||
| Device Manufacturer: | Creative Technology | |
| Product Name: | Creative Technology, PID=800A | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | USB Composite Device | |
| Hardware ID: | USB\VID_0C45&PID_672A | |
| [Driver Information] | ||
| Driver Manufacturer: | (표준 USB 호스트 컨트롤러) | |
| Driver Description: | USB Composite Device | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_0C45&PID_672A\5&165308C1&0&6 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(6) | |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| [Port9] : No Device Connected |
| [Port10] : Intel(R) Wireless Bluetooth(R) |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | Intel(R) Wireless Bluetooth(R) | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | 인텔(R) 무선 Bluetooth(R) | |
| Hardware ID: | USB\VID_8087&PID_0026 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | 인텔(R) 무선 Bluetooth(R) | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 22.70.0.3 | |
| Driver Date: | 09-Jul-2021 | |
| DeviceInstanceId | USB\VID_8087&PID_0026\5&165308C1&0&10 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(10) | |
| [Port11] : No Device Connected |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| Intel Tiger Lake-U/Y PCH-LP - Shared SRAM |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - Shared SRAM | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - Shared SRAM | |
| Device Class: | RAM/Memory Controller | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:20:2 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0EF&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| Memory Base Address 0 | 60552E0000 | |
| Memory Base Address 2 | 60552EA000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | (표준 시스템 장치) | |
| Driver Description: | PCI 표준 RAM 컨트롤러 | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.1202 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0EF&SUBSYS_0AFC1028&REV_30\3&11583659&0&A2 | |
| Location Paths | PCIROOT(0)#PCI(1402) | |
| Killer Wi-Fi 6 AX1650s 160MHz Wireless Network Adapter (201D2W) |
| [General Information] | ||
| Device Name: | Killer Wi-Fi 6 AX1650s 160MHz Wireless Network Adapter (201D2W) | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - CNVi: Wi-Fi | |
| Device Class: | Other Network Adapter | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:20:3 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0F0&SUBSYS_16511A56&REV_30 | |
| [PCI Express] | ||
| Version: | 2.0 | |
| Current Link Width: | Not negotiated | |
| Maximum Link Speed: | 5.0 GT/s | |
| Device/Port Type: | Root Complex Integrated Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | None | |
| Active State Power Management (ASPM) Status: | Disabled | |
| L0s Exit Latency: | < 64 ns | |
| L1 Exit Latency: | < 1 us | |
| Maximum Payload Size Supported: | 128 bytes | |
| Maximum Payload Size: | 128 bytes | |
| Resizable BAR Support: | Not Supported | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 7FFFEE8000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Killer(R) Wi-Fi 6 AX1650s 160MHz Wireless Network Adapter (201D2W) | |
| Driver Provider: | Intel | |
| Driver Version: | 22.70.0.6 | |
| Driver Date: | 29-Jun-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0F0&SUBSYS_16511A56&REV_30\3&11583659&0&A3 | |
| Location Paths | PCIROOT(0)#PCI(1403) | |
| Intel Tiger Lake-U/Y PCH-LP - I2C Controller #0 |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - I2C Controller #0 | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - I2C Controller #0 | |
| Device Class: | Other Serial Bus Controller | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:21:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0E8&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | IRQ27 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 0 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Serial IO I2C Host Controller - A0E8 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.2104.1 | |
| Driver Date: | 19-Jan-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0E8&SUBSYS_0AFC1028&REV_30\3&11583659&0&A8 | |
| Location Paths | PCIROOT(0)#PCI(1500) | |
| Intel Tiger Lake-U/Y PCH-LP - I2C Controller #1 |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - I2C Controller #1 | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - I2C Controller #1 | |
| Device Class: | Other Serial Bus Controller | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:21:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0E9&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | IRQ40 | |
| Interrupt Pin: | INTB# | |
| Memory Base Address 0 | 7FFFEE3000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Serial IO I2C Host Controller - A0E9 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.2104.1 | |
| Driver Date: | 19-Jan-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0E9&SUBSYS_0AFC1028&REV_30\3&11583659&0&A9 | |
| Location Paths | PCIROOT(0)#PCI(1501) | |
| Intel Tiger Lake-U/Y PCH-LP - Intel ME: HECI #1 |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - Intel ME: HECI #1 | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - Intel ME: HECI #1 | |
| Device Class: | Other Communication Device | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:22:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0E0&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 7FFFEE4000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel | |
| Driver Description: | Intel(R) Management Engine Interface #1 | |
| Driver Provider: | Intel | |
| Driver Version: | 2120.100.0.1085 | |
| Driver Date: | 11-May-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0E0&SUBSYS_0AFC1028&REV_30\3&11583659&0&B0 | |
| Location Paths | PCIROOT(0)#PCI(1600) | |
| Intel Tiger Lake-U/Y PCH-LP - I2C Controller #4 |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - I2C Controller #4 | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - I2C Controller #4 | |
| Device Class: | Other Serial Bus Controller | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:25:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0C5&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | IRQ31 | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 7FFFEE5000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Serial IO I2C Host Controller - A0C5 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.2104.1 | |
| Driver Date: | 19-Jan-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0C5&SUBSYS_0AFC1028&REV_30\3&11583659&0&C8 | |
| Location Paths | PCIROOT(0)#PCI(1900) | |
| Intel Tiger Lake-U/Y PCH-LP - I2C Controller #5 |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - I2C Controller #5 | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - I2C Controller #5 | |
| Device Class: | Other Serial Bus Controller | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:25:1 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0C6&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | IRQ32 | |
| Interrupt Pin: | INTB# | |
| Memory Base Address 0 | 0 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Serial IO I2C Host Controller - A0C6 | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.100.2104.1 | |
| Driver Date: | 19-Jan-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0C6&SUBSYS_0AFC1028&REV_30\3&11583659&0&C9 | |
| Location Paths | PCIROOT(0)#PCI(1901) | |
| Intel Tiger Lake-U/Y PCH-LP - PCI Express Root Port #12 |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - PCI Express Root Port #12 | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - PCI Express Root Port #12 | |
| Device Class: | PCI-to-PCI Bridge | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:29:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0B3&SUBSYS_00000000&REV_30 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | Root Port of PCI Express Root Complex | |
| Slot Implemented: | Yes | |
| Hot-Plug: | Not Capable | |
| Hot-Plug Surprise: | Not Capable | |
| Slot Power Limit: | 10.000 W | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | 512 ns - 1 us | |
| L1 Exit Latency: | 8 - 16 us | |
| Maximum Payload Size Supported: | 256 bytes | |
| Maximum Payload Size: | 256 bytes | |
| Resizable BAR Support: | Not Supported | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTD# | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) PCI Express Root Port #12 - A0B3 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.24.5 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0B3&SUBSYS_0AFC1028&REV_30\3&11583659&0&E8 | |
| Location Paths | PCIROOT(0)#PCI(1D00) | |
| PCI Express x1 Bus #113 |
| RealTek Semiconductor PCI-E Card Reader |
| [General Information] | ||
| Device Name: | RealTek Semiconductor PCI-E Card Reader | |
| Original Device Name: | RealTek Semiconductor PCI-E Card Reader | |
| Device Class: | Unknown | |
| Revision ID: | 1 | |
| PCI Address (Bus:Device:Function) Number: | 113:0:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_10EC&DEV_5260&SUBSYS_0AFC1028&REV_01 | |
| [PCI Express] | ||
| Version: | 3.0 | |
| Maximum Link Width: | 1x | |
| Current Link Width: | 1x | |
| Maximum Link Speed: | 8.0 GT/s | |
| Current Link Speed: | 8.0 GT/s | |
| Device/Port Type: | PCI Express Endpoint | |
| Slot Implemented: | No | |
| Emergency Power Reduction: | Not Supported | |
| Active State Power Management (ASPM) Support: | L0s and L1 | |
| Active State Power Management (ASPM) Status: | L1 Entry | |
| L0s Exit Latency: | >4 us | |
| L1 Exit Latency: | >64 us | |
| Maximum Payload Size Supported: | 512 bytes | |
| Maximum Payload Size: | 256 bytes | |
| Resizable BAR Support: | Not Supported | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | A60FF000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Realtek Semiconductor Corp. | |
| Driver Description: | Realtek PCIE CardReader | |
| Driver Provider: | Realtek Semiconductor Corp. | |
| Driver Version: | 10.0.22000.21350 | |
| Driver Date: | 09-Aug-2021 | |
| DeviceInstanceId | PCI\VEN_10EC&DEV_5260&SUBSYS_0AFC1028&REV_01\00000001004CE00000 | |
| Location Paths | PCIROOT(0)#PCI(1D00)#PCI(0000) | |
| Intel Tiger Lake-UP3 PCH-LP - eSPI Controller |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-UP3 PCH-LP - eSPI Controller | |
| Original Device Name: | Intel Tiger Lake-UP3 PCH-LP - eSPI Controller | |
| Device Class: | PCI-to-ISA Bridge | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:31:0 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A082&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) LPC Controller/eSPI Controller (U Premium) - A082 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.24.5 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A082&SUBSYS_0AFC1028&REV_30\3&11583659&0&F8 | |
| Location Paths | PCIROOT(0)#PCI(1F00) | |
| Intel Tiger Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) | |
| Device Class: | Multimedia Audio Adapter | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:31:3 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0C8&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 7FFFEEC000 | |
| Memory Base Address 4 | 7FFFF00000 | |
| [Features] | ||
| Bus Mastering: | Enabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel(R) Corporation | |
| Driver Description: | 인텔(R) 스마트 사운드 기술 오디오 컨트롤러 | |
| Driver Provider: | Intel(R) Corporation | |
| Driver Version: | 10.29.0.6040 | |
| Driver Date: | 07-Jul-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0C8&SUBSYS_0AFC1028&REV_30\3&11583659&0&FB | |
| Location Paths | PCIROOT(0)#PCI(1F03) | |
| Intel Tiger Lake-U/Y PCH-LP - SMBus Host Controller |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - SMBus Host Controller | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - SMBus Host Controller | |
| Device Class: | SMBus (System Management Bus) | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:31:4 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0A3&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | INTA# | |
| Memory Base Address 0 | 60552E4000 | |
| I/O Base Address 4 | EFA0 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) SMBus - A0A3 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.24.5 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0A3&SUBSYS_0AFC1028&REV_30\3&11583659&0&FC | |
| Location Paths | PCIROOT(0)#PCI(1F04) | |
| Intel Tiger Lake-U/Y PCH-LP - SPI (flash) Controller |
| [General Information] | ||
| Device Name: | Intel Tiger Lake-U/Y PCH-LP - SPI (flash) Controller | |
| Original Device Name: | Intel Tiger Lake-U/Y PCH-LP - SPI (flash) Controller | |
| Device Class: | Other Serial Bus Controller | |
| Revision ID: | 30 | |
| PCI Address (Bus:Device:Function) Number: | 0:31:5 | |
| PCI Latency Timer: | 0 | |
| Hardware ID: | PCI\VEN_8086&DEV_A0A4&SUBSYS_0AFC1028&REV_30 | |
| [System Resources] | ||
| Interrupt Line: | N/A | |
| Interrupt Pin: | N/A | |
| Memory Base Address 0 | FE010000 | |
| [Features] | ||
| Bus Mastering: | Disabled | |
| Running At 66 MHz: | Not Capable | |
| Fast Back-to-Back Transactions: | Not Capable | |
| [Driver Information] | ||
| Driver Manufacturer: | INTEL | |
| Driver Description: | Intel(R) SPI (flash) Controller - A0A4 | |
| Driver Provider: | INTEL | |
| Driver Version: | 10.1.24.5 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0A4&SUBSYS_0AFC1028&REV_30\3&11583659&0&FD | |
| Location Paths | PCIROOT(0)#PCI(1F05) | |
| Video Adapter |
| Intel Iris Xe Graphics |
| [Video chipset] | ||
| Video Chipset: | Intel Iris Xe Graphics | |
| Video Chipset Codename: | Tiger Lake-UP3 GT2 | |
| Video Memory: | 1024 MBytes of LPDDR4 | |
| [Video Card] | ||
| Video Card: | Intel Tiger Lake-UP3 - GT2 Integrated Graphics [DELL] | |
| Video Bus: | Integrated | |
| Video RAMDAC: | Internal | |
| [Performance] | ||
| Graphics Processor Clock: | 100.8 MHz | |
| Graphics Memory Clock: | 2149.0 MHz (Effective 4298.0 MHz) | |
| Graphics Memory Bus Width: | 128-bit | |
| Number Of ALUs (cores): | 768 | |
| Number Of EUs (Execution Units): | 96 | |
| Resizable BAR Support: | Not Supported | |
| Hardware ID: | PCI\VEN_8086&DEV_9A49&SUBSYS_0AFC1028&REV_03 | |
| PCI Location (Bus:Dev:Fnc): | 0:02:0 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Intel(R) Iris(R) Xe Graphics | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 30.0.100.9955 | |
| Driver Date: | 07-Oct-2021 | |
| DCH/UWD Driver: | Capable | |
| DeviceInstanceId | PCI\VEN_8086&DEV_9A49&SUBSYS_0AFC1028&REV_03\3&11583659&0&10 | |
| Location Paths | PCIROOT(0)#PCI(0200) | |
| Monitor |
| SAMSUNG [Unknown Model: SDC414F] |
| [General information] | ||
| Monitor Name: | SAMSUNG [Unknown Model: SDC414F] | |
| Monitor Name (Manuf): | 134XK01 [DELL P/N: 4XG21] | |
| Serial Number: | Unknown | |
| Date Of Manufacture: | Week: 17, Year: 2020 | |
| Monitor Hardware ID: | Monitor\SDC414F | |
| Max. Vertical Size: | 18 cm | |
| Max. Horizontal Size: | 29 cm | |
| [Advanced parameters] | ||
| Input Signal: | Digital | |
| Color Bit Depth: | 10 Bits per Primary Color | |
| Digital Video Interface Standard Supported: | DisplayPort | |
| Gamma Factor: | 2.20 | |
| [DPMS Modes] | ||
| Standby: | Not Supported | |
| Suspend: | Not Supported | |
| Active Off: | Not Supported | |
| Standard Colour Space (sRGB) Default: | Not Supported | |
| Preferred Timing Mode: | Supported | |
| Default GTF (Continuous Frequency): | Not Supported | |
| DFP 1.x Compatible: | Yes | |
| [Supported Video Modes] | ||
| 3456 x 2160 | 288 x 180 mm, Pixel Clock 528.19 MHz | |
| 3456 x 2160 | 288 x 180 mm, Pixel Clock 528.19 MHz | |
| Drives |
| (S)ATA/ATAPI Drives |
| NVMe Drives |
| PC711 NVMe SK hynix 1TB |
| [General Information] | ||
| Drive Controller: | NVMe | |
| Host Controller: | Intel Tiger Lake - Volume Management Device (VMD) NVMe RAID Controller | |
| Drive Model: | PC711 NVMe SK hynix 1TB | |
| Drive Serial Number: | AJA7N44151040760A | |
| Drive Firmware Revision: | 41001131 | |
| NVMe Version Supported: | v1.3 | |
| Drive Capacity: | 976,762 MBytes (1024 GB) | |
| Drive Capacity [MB]: | 976762 | |
| [Capabilities] | ||
| Volatile Write Cache: | Present | |
| Compare Command: | Supported | |
| Write Uncorrectable Command: | Supported | |
| Dataset Management: | Supported | |
| Write Zeroes: | Supported | |
| Save field set to a non-zero value: | Supported | |
| Reservations: | Not Supported | |
| Timestamp: | Supported | |
| Autonomous Power State Transitions: | Supported | |
| [Self-Monitoring, Analysis and Reporting Technology (S.M.A.R.T.)] | ||
| Available Space Below Threshold: | OK | |
| Temperature Exceeded Critical Threshold: | OK | |
| Device Reliablity Degraded: | OK | |
| Media In Read Only Mode: | OK | |
| Volatile Memory Backup Device Failed: | OK | |
| Drive Temperature: | 42 °C | |
| Warning Temperature Threshold: | 83 °C | |
| Critical Temperature Threshold: | 85 °C | |
| Time Above Warning Temperature Threshold: | 0 minutes | |
| Time Above Critical Temperature Threshold: | 0 minutes | |
| Spare Capacity Available: | 100% | |
| Device Health: | 100% | |
| Power Cycles: | 28 | |
| Power On Hours: | 51 hours | |
| Unsafe Shutdowns: | 14 | |
| Media Errors: | 0 | |
| Total Host Reads: | 454 GBytes | |
| Total Host Writes: | 515 GBytes | |
| Audio |
| Intel Tiger Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) |
| Audio Adapter: | Intel Tiger Lake-U/Y PCH-LP - cAVS (Audio, Voice, Speech) | |
| Audio Controller Hardware ID: | PCI\VEN_8086&DEV_A0C8&SUBSYS_0AFC1028&REV_30 |
| Network |
| Killer Wi-Fi 6 AX1650s 160MHz Wireless Network Adapter (201D2W) |
| [General information] | ||
| Network Card: | Killer Wi-Fi 6 AX1650s 160MHz Wireless Network Adapter (201D2W) | |
| Vendor Description: | Microsoft | |
| MAC Address: | 4C-79-6E-D9-87-21 | |
| [Capabilities] | ||
| Maximum Link Speed: | 866 Mbps | |
| Transmit Buffer Size: | 9 Bytes | |
| Receive Buffer Size: | 9 Bytes | |
| Hardware ID: | PCI\VEN_8086&DEV_A0F0&SUBSYS_16511A56&REV_30 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | Killer(R) Wi-Fi 6 AX1650s 160MHz Wireless Network Adapter (201D2W) | |
| Driver Provider: | Intel | |
| Driver Version: | 22.70.0.6 | |
| Driver Date: | 29-Jun-2021 | |
| DeviceInstanceId | PCI\VEN_8086&DEV_A0F0&SUBSYS_16511A56&REV_30\3&11583659&0&A3 | |
| Location Paths | PCIROOT(0)#PCI(1403) | |
| Ports |
| Serial Ports |
| USB |
| Intel(R) USB 3.10 확장 가능한 호스트 컨트롤러 - 1.20(Microsoft) |
| Root Hub |
| [Port1] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : Goodix fingerprint |
| [Device Information] | ||
| Device Manufacturer: | - | |
| Product Name: | - | |
| Serial Number: | - | |
| USB Version Supported: | 2.00 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | Goodix fingerprint | |
| Hardware ID: | USB\VID_27C6&PID_533C | |
| [Driver Information] | ||
| Driver Manufacturer: | Goodix | |
| Driver Description: | Goodix fingerprint | |
| Driver Provider: | Goodix | |
| Driver Version: | 3.0.37.600 | |
| Driver Date: | 08-Jun-2020 | |
| DeviceInstanceId | USB\VID_27C6&PID_533C\5&165308C1&0&3 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(3) | |
| [Port4] : No Device Connected |
| [Port5] : No Device Connected |
| [Port6] : Creative Technology, PID=800A |
| [Device Information] | ||
| Device Manufacturer: | Creative Technology | |
| Product Name: | Creative Technology, PID=800A | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 2.0 High-speed | |
| Driver Description: | USB Composite Device | |
| Hardware ID: | USB\VID_0C45&PID_672A | |
| [Driver Information] | ||
| Driver Manufacturer: | (표준 USB 호스트 컨트롤러) | |
| Driver Description: | USB Composite Device | |
| Driver Provider: | Microsoft | |
| Driver Version: | 10.0.19041.488 | |
| Driver Date: | 21-Jun-2006 | |
| DeviceInstanceId | USB\VID_0C45&PID_672A\5&165308C1&0&6 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(6) | |
| [Port7] : No Device Connected |
| [Port8] : No Device Connected |
| [Port9] : No Device Connected |
| [Port10] : Intel(R) Wireless Bluetooth(R) |
| [Device Information] | ||
| Device Manufacturer: | Intel | |
| Product Name: | Intel(R) Wireless Bluetooth(R) | |
| Serial Number: | - | |
| USB Version Supported: | 2.01 | |
| USB Device Speed: | USB 1.1 Full-speed | |
| Driver Description: | 인텔(R) 무선 Bluetooth(R) | |
| Hardware ID: | USB\VID_8087&PID_0026 | |
| [Driver Information] | ||
| Driver Manufacturer: | Intel Corporation | |
| Driver Description: | 인텔(R) 무선 Bluetooth(R) | |
| Driver Provider: | Intel Corporation | |
| Driver Version: | 22.70.0.3 | |
| Driver Date: | 09-Jul-2021 | |
| DeviceInstanceId | USB\VID_8087&PID_0026\5&165308C1&0&10 | |
| Location Paths | PCIROOT(0)#PCI(1400)#USBROOT(0)#USB(10) | |
| [Port11] : No Device Connected |
| [Port12] : No Device Connected |
| [Port13] : No Device Connected |
| [Port14] : No Device Connected |
| [Port15] : No Device Connected |
| [Port16] : No Device Connected |
| Intel(R) USB 3.10 확장 가능한 호스트 컨트롤러 - 1.20(Microsoft) |
| Root Hub |
| [Port1] : No Device Connected |
| [Port2] : No Device Connected |
| [Port3] : No Device Connected |
| [Port4] : No Device Connected |
| [Port5] : No Device Connected |
| Smart Battery |
| Battery #0 |
| [General Properties] | ||
| Device Name: | DELL WN0N016 | |
| Manufacturer Name: | SMP | |
| Serial Number: | 1767 | |
| Unique ID: | 1767SMPDELL WN0N016 | |
| Chemistry: | ||
| Designed Capacity: | 50973 mWh | |
| Full Charged Capacity: | 50973 mWh | |
| Wear Level: | 0.0 % | |
| [Current Power Status] | ||
| Power Status: | Charging On AC Power | |
| Current Capacity: | 49605 mWh (97.3 %) | |
| Current Voltage: | 8.869 V | |
| Charge Rate: | 4765 mW | |